C23H29NO6 — CID 40551436
3-methylbutyl (2S)-2-phenyl-2-[(3,4,5-trimethoxybenzoyl)amino]acetate (PubChem CID 40551436) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is 3-methylbutyl (2S)-2-phenyl-2-[(3,4,5-trimethoxybenzoyl)amino]acetate.
| Compound Name | 3-methylbutyl (2S)-2-phenyl-2-[(3,4,5-trimethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 40551436 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 3-methylbutyl (2S)-2-phenyl-2-[(3,4,5-trimethoxybenzoyl)amino]acetate |
| SMILES | COc1cc(C(=O)N[C@H](C(=O)OCCC(C)C)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H29NO6/c1-15(2)11-12-30-23(26)20(16-9-7-6-8-10-16)24-22(25)17-13-18(27-3)21(29-5)19(14-17)28-4/h6-10,13-15,20H,11-12H2,1-5H3,(H,24,25)/t20-/m0/s1 |
| InChIKey | HCYOVKGEOKOZHQ-FQEVSTJZSA-N |
| XLogP | 3.77 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |