C21H25NO3S — CID 40566071
3-methylbutyl (2S)-2-[(2-methylsulfanylbenzoyl)amino]-2-phenylacetate (PubChem CID 40566071) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is 3-methylbutyl (2S)-2-[(2-methylsulfanylbenzoyl)amino]-2-phenylacetate.
| Compound Name | 3-methylbutyl (2S)-2-[(2-methylsulfanylbenzoyl)amino]-2-phenylacetate |
|---|---|
| PubChem CID | 40566071 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 3-methylbutyl (2S)-2-[(2-methylsulfanylbenzoyl)amino]-2-phenylacetate |
| SMILES | CSc1ccccc1C(=O)N[C@H](C(=O)OCCC(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H25NO3S/c1-15(2)13-14-25-21(24)19(16-9-5-4-6-10-16)22-20(23)17-11-7-8-12-18(17)26-3/h4-12,15,19H,13-14H2,1-3H3,(H,22,23)/t19-/m0/s1 |
| InChIKey | HRAMWEJGRQCJGH-IBGZPJMESA-N |
| XLogP | 4.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |