C20H23NO6 — CID 3091440
methyl 3-phenyl-2-[(3,4,5-trimethoxybenzoyl)amino]propanoate (PubChem CID 3091440) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is methyl 3-phenyl-2-[(3,4,5-trimethoxybenzoyl)amino]propanoate.
| Compound Name | methyl 3-phenyl-2-[(3,4,5-trimethoxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 3091440 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | methyl 3-phenyl-2-[(3,4,5-trimethoxybenzoyl)amino]propanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H23NO6/c1-24-16-11-14(12-17(25-2)18(16)26-3)19(22)21-15(20(23)27-4)10-13-8-6-5-7-9-13/h5-9,11-12,15H,10H2,1-4H3,(H,21,22) |
| InChIKey | ISYFSYQOCAJJHT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |