C19H21NO5 — CID 10360063
methyl (2S)-2-[(3,4-dimethoxybenzoyl)amino]-3-phenylpropanoate (PubChem CID 10360063) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl (2S)-2-[(3,4-dimethoxybenzoyl)amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[(3,4-dimethoxybenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10360063 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | methyl (2S)-2-[(3,4-dimethoxybenzoyl)amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H21NO5/c1-23-16-10-9-14(12-17(16)24-2)18(21)20-15(19(22)25-3)11-13-7-5-4-6-8-13/h4-10,12,15H,11H2,1-3H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | AYUOUVRBTAJZAP-HNNXBMFYSA-N |
| XLogP | 2.22 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |