C23H28N2O6 — CID 51064831
methyl 2-[4-[(3,4-dimethoxybenzoyl)amino]butanoylamino]-3-phenylpropanoate (PubChem CID 51064831) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is methyl 2-[4-[(3,4-dimethoxybenzoyl)amino]butanoylamino]-3-phenylpropanoate.
| Compound Name | methyl 2-[4-[(3,4-dimethoxybenzoyl)amino]butanoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 51064831 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | methyl 2-[4-[(3,4-dimethoxybenzoyl)amino]butanoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)CCCNC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H28N2O6/c1-29-19-12-11-17(15-20(19)30-2)22(27)24-13-7-10-21(26)25-18(23(28)31-3)14-16-8-5-4-6-9-16/h4-6,8-9,11-12,15,18H,7,10,13-14H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | ZAHYRDQLDNDYSK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|