C13H17NO6 — CID 9277507
methyl (2S)-2-[(3,4-dimethoxybenzoyl)amino]-3-hydroxypropanoate (PubChem CID 9277507) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is methyl (2S)-2-[(3,4-dimethoxybenzoyl)amino]-3-hydroxypropanoate.
| Compound Name | methyl (2S)-2-[(3,4-dimethoxybenzoyl)amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 9277507 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | methyl (2S)-2-[(3,4-dimethoxybenzoyl)amino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@H](CO)NC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H17NO6/c1-18-10-5-4-8(6-11(10)19-2)12(16)14-9(7-15)13(17)20-3/h4-6,9,15H,7H2,1-3H3,(H,14,16)/t9-/m0/s1 |
| InChIKey | MTYMMXJMKPZWGS-VIFPVBQESA-N |
| XLogP | -0.03 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |