C15H16F3NO5 — CID 11013454
methyl (2R)-3-hydroxy-2-[[4-prop-2-enoxy-3-(trifluoromethyl)benzoyl]amino]propanoate (PubChem CID 11013454) has the molecular formula C15H16F3NO5 and a molecular weight of 347.29 g/mol. Its IUPAC name is methyl (2R)-3-hydroxy-2-[[4-prop-2-enoxy-3-(trifluoromethyl)benzoyl]amino]propanoate.
| Compound Name | methyl (2R)-3-hydroxy-2-[[4-prop-2-enoxy-3-(trifluoromethyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 11013454 |
| Molecular Formula | C15H16F3NO5 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | methyl (2R)-3-hydroxy-2-[[4-prop-2-enoxy-3-(trifluoromethyl)benzoyl]amino]propanoate |
| SMILES | C=CCOc1ccc(C(=O)N[C@H](CO)C(=O)OC)cc1C(F)(F)F |
| InChI | InChI=1S/C15H16F3NO5/c1-3-6-24-12-5-4-9(7-10(12)15(16,17)18)13(21)19-11(8-20)14(22)23-2/h3-5,7,11,20H,1,6,8H2,2H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | NASNFQPUTBTRAG-LLVKDONJSA-N |
| XLogP | 1.53 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|