C16H15F5N2O6 — CID 171341611
methyl (2S)-2-[[4-nitro-3-(2,2,3,3,3-pentafluoropropoxy)benzoyl]amino]pent-4-enoate (PubChem CID 171341611) has the molecular formula C16H15F5N2O6 and a molecular weight of 426.29 g/mol. Its IUPAC name is methyl (2S)-2-[[4-nitro-3-(2,2,3,3,3-pentafluoropropoxy)benzoyl]amino]pent-4-enoate.
| Compound Name | methyl (2S)-2-[[4-nitro-3-(2,2,3,3,3-pentafluoropropoxy)benzoyl]amino]pent-4-enoate |
|---|---|
| PubChem CID | 171341611 |
| Molecular Formula | C16H15F5N2O6 |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | methyl (2S)-2-[[4-nitro-3-(2,2,3,3,3-pentafluoropropoxy)benzoyl]amino]pent-4-enoate |
| SMILES | C=CC[C@H](NC(=O)c1ccc([N+](=O)[O-])c(OCC(F)(F)C(F)(F)F)c1)C(=O)OC |
| InChI | InChI=1S/C16H15F5N2O6/c1-3-4-10(14(25)28-2)22-13(24)9-5-6-11(23(26)27)12(7-9)29-8-15(17,18)16(19,20)21/h3,5-7,10H,1,4,8H2,2H3,(H,22,24)/t10-/m0/s1 |
| InChIKey | XTALJHOMEAYVKP-JTQLQIEISA-N |
| XLogP | 3.02 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|