C16H11F5N2O8 — CID 171341700
2-[[4-nitro-3-(2,2,3,3,3-pentafluoropropoxy)benzoyl]amino]-2-prop-2-ynylpropanedioic acid (PubChem CID 171341700) has the molecular formula C16H11F5N2O8 and a molecular weight of 454.26 g/mol. Its IUPAC name is 2-[[4-nitro-3-(2,2,3,3,3-pentafluoropropoxy)benzoyl]amino]-2-prop-2-ynylpropanedioic acid.
| Compound Name | 2-[[4-nitro-3-(2,2,3,3,3-pentafluoropropoxy)benzoyl]amino]-2-prop-2-ynylpropanedioic acid |
|---|---|
| PubChem CID | 171341700 |
| Molecular Formula | C16H11F5N2O8 |
| Molecular Weight | 454.26 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | 2-[[4-nitro-3-(2,2,3,3,3-pentafluoropropoxy)benzoyl]amino]-2-prop-2-ynylpropanedioic acid |
| SMILES | C#CCC(NC(=O)c1ccc([N+](=O)[O-])c(OCC(F)(F)C(F)(F)F)c1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H11F5N2O8/c1-2-5-14(12(25)26,13(27)28)22-11(24)8-3-4-9(23(29)30)10(6-8)31-7-15(17,18)16(19,20)21/h1,3-4,6H,5,7H2,(H,22,24)(H,25,26)(H,27,28) |
| InChIKey | VGEAWHVCINSDQC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 156.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|