C17H16F5N3O6 — CID 171341624
methyl (2S)-5-cyano-2-[[4-nitro-3-(2,2,3,3,3-pentafluoropropoxy)benzoyl]amino]pentanoate (PubChem CID 171341624) has the molecular formula C17H16F5N3O6 and a molecular weight of 453.32 g/mol. Its IUPAC name is methyl (2S)-5-cyano-2-[[4-nitro-3-(2,2,3,3,3-pentafluoropropoxy)benzoyl]amino]pentanoate.
| Compound Name | methyl (2S)-5-cyano-2-[[4-nitro-3-(2,2,3,3,3-pentafluoropropoxy)benzoyl]amino]pentanoate |
|---|---|
| PubChem CID | 171341624 |
| Molecular Formula | C17H16F5N3O6 |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | methyl (2S)-5-cyano-2-[[4-nitro-3-(2,2,3,3,3-pentafluoropropoxy)benzoyl]amino]pentanoate |
| SMILES | COC(=O)[C@H](CCCC#N)NC(=O)c1ccc([N+](=O)[O-])c(OCC(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F5N3O6/c1-30-15(27)11(4-2-3-7-23)24-14(26)10-5-6-12(25(28)29)13(8-10)31-9-16(18,19)17(20,21)22/h5-6,8,11H,2-4,9H2,1H3,(H,24,26)/t11-/m0/s1 |
| InChIKey | PVAWKXNVTFCJNT-NSHDSACASA-N |
| XLogP | 3.14 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|