C16H16F5N5O6 — CID 171341626
methyl (2S)-5-azido-2-[[4-nitro-3-(2,2,3,3,3-pentafluoropropoxy)benzoyl]amino]pentanoate (PubChem CID 171341626) has the molecular formula C16H16F5N5O6 and a molecular weight of 469.32 g/mol. Its IUPAC name is methyl (2S)-5-azido-2-[[4-nitro-3-(2,2,3,3,3-pentafluoropropoxy)benzoyl]amino]pentanoate.
| Compound Name | methyl (2S)-5-azido-2-[[4-nitro-3-(2,2,3,3,3-pentafluoropropoxy)benzoyl]amino]pentanoate |
|---|---|
| PubChem CID | 171341626 |
| Molecular Formula | C16H16F5N5O6 |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | methyl (2S)-5-azido-2-[[4-nitro-3-(2,2,3,3,3-pentafluoropropoxy)benzoyl]amino]pentanoate |
| SMILES | COC(=O)[C@H](CCCN=[N+]=[N-])NC(=O)c1ccc([N+](=O)[O-])c(OCC(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H16F5N5O6/c1-31-14(28)10(3-2-6-23-25-22)24-13(27)9-4-5-11(26(29)30)12(7-9)32-8-15(17,18)16(19,20)21/h4-5,7,10H,2-3,6,8H2,1H3,(H,24,27)/t10-/m0/s1 |
| InChIKey | NGXFNVKBIAZFDK-JTQLQIEISA-N |
| XLogP | 3.53 |
| TPSA | 156.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|