C12H14N2O6 — CID 67549024
methyl (2S)-3-hydroxy-2-[(3-methyl-4-nitrobenzoyl)amino]propanoate (PubChem CID 67549024) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is methyl (2S)-3-hydroxy-2-[(3-methyl-4-nitrobenzoyl)amino]propanoate.
| Compound Name | methyl (2S)-3-hydroxy-2-[(3-methyl-4-nitrobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 67549024 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | methyl (2S)-3-hydroxy-2-[(3-methyl-4-nitrobenzoyl)amino]propanoate |
| SMILES | COC(=O)[C@H](CO)NC(=O)c1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C12H14N2O6/c1-7-5-8(3-4-10(7)14(18)19)11(16)13-9(6-15)12(17)20-2/h3-5,9,15H,6H2,1-2H3,(H,13,16)/t9-/m0/s1 |
| InChIKey | SJXZIQUIWURFDF-VIFPVBQESA-N |
| XLogP | 0.17 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|