C11H11F2NO4 — CID 9277581
methyl (2R)-2-[(3,4-difluorobenzoyl)amino]-3-hydroxypropanoate (PubChem CID 9277581) has the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. Its IUPAC name is methyl (2R)-2-[(3,4-difluorobenzoyl)amino]-3-hydroxypropanoate.
| Compound Name | methyl (2R)-2-[(3,4-difluorobenzoyl)amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 9277581 |
| Molecular Formula | C11H11F2NO4 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | methyl (2R)-2-[(3,4-difluorobenzoyl)amino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@@H](CO)NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H11F2NO4/c1-18-11(17)9(5-15)14-10(16)6-2-3-7(12)8(13)4-6/h2-4,9,15H,5H2,1H3,(H,14,16)/t9-/m1/s1 |
| InChIKey | WTYFOZCEYSLPGW-SECBINFHSA-N |
| XLogP | 0.23 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |