C17H15F2NO3 — CID 38031742
methyl (2S)-2-[(3,4-difluorobenzoyl)amino]-3-phenylpropanoate (PubChem CID 38031742) has the molecular formula C17H15F2NO3 and a molecular weight of 319.31 g/mol. Its IUPAC name is methyl (2S)-2-[(3,4-difluorobenzoyl)amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[(3,4-difluorobenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 38031742 |
| Molecular Formula | C17H15F2NO3 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | methyl (2S)-2-[(3,4-difluorobenzoyl)amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H15F2NO3/c1-23-17(22)15(9-11-5-3-2-4-6-11)20-16(21)12-7-8-13(18)14(19)10-12/h2-8,10,15H,9H2,1H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | IERLOSGYMKLBJJ-HNNXBMFYSA-N |
| XLogP | 2.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |