C17H16INO3 — CID 8010917
methyl (2S)-2-[(3-iodobenzoyl)amino]-3-phenylpropanoate (PubChem CID 8010917) has the molecular formula C17H16INO3 and a molecular weight of 409.22 g/mol. Its IUPAC name is methyl (2S)-2-[(3-iodobenzoyl)amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[(3-iodobenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 8010917 |
| Molecular Formula | C17H16INO3 |
| Molecular Weight | 409.22 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | methyl (2S)-2-[(3-iodobenzoyl)amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C17H16INO3/c1-22-17(21)15(10-12-6-3-2-4-7-12)19-16(20)13-8-5-9-14(18)11-13/h2-9,11,15H,10H2,1H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | DRGMFLVIRPXJTQ-HNNXBMFYSA-N |
| XLogP | 2.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|