C23H22INO3 — CID 97037048
N-[(1R)-1-(3,4-dimethoxyphenyl)-2-phenylethyl]-3-iodobenzamide (PubChem CID 97037048) has the molecular formula C23H22INO3 and a molecular weight of 487.34 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-dimethoxyphenyl)-2-phenylethyl]-3-iodobenzamide.
| Compound Name | N-[(1R)-1-(3,4-dimethoxyphenyl)-2-phenylethyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 97037048 |
| Molecular Formula | C23H22INO3 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | N-[(1R)-1-(3,4-dimethoxyphenyl)-2-phenylethyl]-3-iodobenzamide |
| SMILES | COc1ccc([C@@H](Cc2ccccc2)NC(=O)c2cccc(I)c2)cc1OC |
| InChI | InChI=1S/C23H22INO3/c1-27-21-12-11-17(15-22(21)28-2)20(13-16-7-4-3-5-8-16)25-23(26)18-9-6-10-19(24)14-18/h3-12,14-15,20H,13H2,1-2H3,(H,25,26)/t20-/m1/s1 |
| InChIKey | ISKVZHIZFRWVAB-HXUWFJFHSA-N |
| XLogP | 5.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|