C23H22FNO3 — CID 4318672
N-[1-(3,4-dimethoxyphenyl)-2-phenylethyl]-4-fluorobenzamide (PubChem CID 4318672) has the molecular formula C23H22FNO3 and a molecular weight of 379.43 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)-2-phenylethyl]-4-fluorobenzamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)-2-phenylethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 4318672 |
| Molecular Formula | C23H22FNO3 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)-2-phenylethyl]-4-fluorobenzamide |
| SMILES | COc1ccc(C(Cc2ccccc2)NC(=O)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C23H22FNO3/c1-27-21-13-10-18(15-22(21)28-2)20(14-16-6-4-3-5-7-16)25-23(26)17-8-11-19(24)12-9-17/h3-13,15,20H,14H2,1-2H3,(H,25,26) |
| InChIKey | JNGVQDDAPYEGLE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |