C22H20FNO2 — CID 27708301
N-[(1R)-1,2-diphenylethyl]-3-fluoro-4-methoxybenzamide (PubChem CID 27708301) has the molecular formula C22H20FNO2 and a molecular weight of 349.41 g/mol. Its IUPAC name is N-[(1R)-1,2-diphenylethyl]-3-fluoro-4-methoxybenzamide.
| Compound Name | N-[(1R)-1,2-diphenylethyl]-3-fluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 27708301 |
| Molecular Formula | C22H20FNO2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[(1R)-1,2-diphenylethyl]-3-fluoro-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@H](Cc2ccccc2)c2ccccc2)cc1F |
| InChI | InChI=1S/C22H20FNO2/c1-26-21-13-12-18(15-19(21)23)22(25)24-20(17-10-6-3-7-11-17)14-16-8-4-2-5-9-16/h2-13,15,20H,14H2,1H3,(H,24,25)/t20-/m1/s1 |
| InChIKey | JKLUGCQTILGDGL-HXUWFJFHSA-N |
| XLogP | 4.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |