C22H20FNO2 — CID 100613122
3-fluoro-4-methoxy-N-[(R)-(2-methylphenyl)-phenylmethyl]benzamide (PubChem CID 100613122) has the molecular formula C22H20FNO2 and a molecular weight of 349.41 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-N-[(R)-(2-methylphenyl)-phenylmethyl]benzamide.
| Compound Name | 3-fluoro-4-methoxy-N-[(R)-(2-methylphenyl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 100613122 |
| Molecular Formula | C22H20FNO2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 3-fluoro-4-methoxy-N-[(R)-(2-methylphenyl)-phenylmethyl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@H](c2ccccc2)c2ccccc2C)cc1F |
| InChI | InChI=1S/C22H20FNO2/c1-15-8-6-7-11-18(15)21(16-9-4-3-5-10-16)24-22(25)17-12-13-20(26-2)19(23)14-17/h3-14,21H,1-2H3,(H,24,25)/t21-/m1/s1 |
| InChIKey | DHHHQNCRAOIBQM-OAQYLSRUSA-N |
| XLogP | 4.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |