C21H18INO — CID 132610512
4-iodo-N-[(2-methylphenyl)-phenylmethyl]benzamide (PubChem CID 132610512) has the molecular formula C21H18INO and a molecular weight of 427.29 g/mol. Its IUPAC name is 4-iodo-N-[(2-methylphenyl)-phenylmethyl]benzamide.
| Compound Name | 4-iodo-N-[(2-methylphenyl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 132610512 |
| Molecular Formula | C21H18INO |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 4-iodo-N-[(2-methylphenyl)-phenylmethyl]benzamide |
| SMILES | Cc1ccccc1C(NC(=O)c1ccc(I)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H18INO/c1-15-7-5-6-10-19(15)20(16-8-3-2-4-9-16)23-21(24)17-11-13-18(22)14-12-17/h2-14,20H,1H3,(H,23,24) |
| InChIKey | DPRNXJTZTMLKKQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|