C26H28N2O — CID 93487464
N-[(R)-(2-methylphenyl)-phenylmethyl]-4-piperidin-1-ylbenzamide (PubChem CID 93487464) has the molecular formula C26H28N2O and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[(R)-(2-methylphenyl)-phenylmethyl]-4-piperidin-1-ylbenzamide.
| Compound Name | N-[(R)-(2-methylphenyl)-phenylmethyl]-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 93487464 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-[(R)-(2-methylphenyl)-phenylmethyl]-4-piperidin-1-ylbenzamide |
| SMILES | Cc1ccccc1[C@H](NC(=O)c1ccc(N2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O/c1-20-10-6-7-13-24(20)25(21-11-4-2-5-12-21)27-26(29)22-14-16-23(17-15-22)28-18-8-3-9-19-28/h2,4-7,10-17,25H,3,8-9,18-19H2,1H3,(H,27,29)/t25-/m1/s1 |
| InChIKey | VNRAXCXIPOWQNA-RUZDIDTESA-N |
| XLogP | 5.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |