C25H25ClN2O3S — CID 38017636
4-chloro-N-[(R)-(2-methylphenyl)-phenylmethyl]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 38017636) has the molecular formula C25H25ClN2O3S and a molecular weight of 469.01 g/mol. Its IUPAC name is 4-chloro-N-[(R)-(2-methylphenyl)-phenylmethyl]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[(R)-(2-methylphenyl)-phenylmethyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 38017636 |
| Molecular Formula | C25H25ClN2O3S |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 4-chloro-N-[(R)-(2-methylphenyl)-phenylmethyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | Cc1ccccc1[C@H](NC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C25H25ClN2O3S/c1-18-9-5-6-12-21(18)24(19-10-3-2-4-11-19)27-25(29)20-13-14-22(26)23(17-20)32(30,31)28-15-7-8-16-28/h2-6,9-14,17,24H,7-8,15-16H2,1H3,(H,27,29)/t24-/m1/s1 |
| InChIKey | GHADEBAIYMOGEQ-XMMPIXPASA-N |
| XLogP | 4.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |