C23H29ClN2O3S — CID 132674694
3-(azepan-1-ylsulfonyl)-4-chloro-N-[1-(3,4-dimethylphenyl)ethyl]benzamide (PubChem CID 132674694) has the molecular formula C23H29ClN2O3S and a molecular weight of 449.02 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-4-chloro-N-[1-(3,4-dimethylphenyl)ethyl]benzamide.
| Compound Name | 3-(azepan-1-ylsulfonyl)-4-chloro-N-[1-(3,4-dimethylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 132674694 |
| Molecular Formula | C23H29ClN2O3S |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-4-chloro-N-[1-(3,4-dimethylphenyl)ethyl]benzamide |
| SMILES | Cc1ccc(C(C)NC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCCC3)c2)cc1C |
| InChI | InChI=1S/C23H29ClN2O3S/c1-16-8-9-19(14-17(16)2)18(3)25-23(27)20-10-11-21(24)22(15-20)30(28,29)26-12-6-4-5-7-13-26/h8-11,14-15,18H,4-7,12-13H2,1-3H3,(H,25,27) |
| InChIKey | VRICXJSLERPTFS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |