C27H29N3OS — CID 133215751
1-[(2-methylphenyl)-phenylmethyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea (PubChem CID 133215751) has the molecular formula C27H29N3OS and a molecular weight of 443.62 g/mol. Its IUPAC name is 1-[(2-methylphenyl)-phenylmethyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea.
| Compound Name | 1-[(2-methylphenyl)-phenylmethyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea |
|---|---|
| PubChem CID | 133215751 |
| Molecular Formula | C27H29N3OS |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 1-[(2-methylphenyl)-phenylmethyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea |
| SMILES | Cc1ccccc1C(NC(=S)Nc1ccc(C(=O)N2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H29N3OS/c1-20-10-6-7-13-24(20)25(21-11-4-2-5-12-21)29-27(32)28-23-16-14-22(15-17-23)26(31)30-18-8-3-9-19-30/h2,4-7,10-17,25H,3,8-9,18-19H2,1H3,(H2,28,29,32) |
| InChIKey | YFAARSNAZIHQTK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|