C20H22FNO4 — CID 24550128
N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-methoxy-4-prop-2-enoxybenzamide (PubChem CID 24550128) has the molecular formula C20H22FNO4 and a molecular weight of 359.40 g/mol. Its IUPAC name is N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-methoxy-4-prop-2-enoxybenzamide.
| Compound Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-methoxy-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 24550128 |
| Molecular Formula | C20H22FNO4 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-methoxy-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)NC(C)c2ccc(OC)c(F)c2)cc1OC |
| InChI | InChI=1S/C20H22FNO4/c1-5-10-26-18-9-7-15(12-19(18)25-4)20(23)22-13(2)14-6-8-17(24-3)16(21)11-14/h5-9,11-13H,1,10H2,2-4H3,(H,22,23) |
| InChIKey | ANCRQEYOGXDFOD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|