C19H22FNO5 — CID 46655748
N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 46655748) has the molecular formula C19H22FNO5 and a molecular weight of 363.39 g/mol. Its IUPAC name is N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 46655748 |
| Molecular Formula | C19H22FNO5 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1ccc(C(C)NC(=O)c2cc(OC)c(OC)c(OC)c2)cc1F |
| InChI | InChI=1S/C19H22FNO5/c1-11(12-6-7-15(23-2)14(20)8-12)21-19(22)13-9-16(24-3)18(26-5)17(10-13)25-4/h6-11H,1-5H3,(H,21,22) |
| InChIKey | ADIIVRAHVMRENN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |