C17H15F4NO2 — CID 17427065
N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 17427065) has the molecular formula C17H15F4NO2 and a molecular weight of 341.30 g/mol. Its IUPAC name is N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 17427065 |
| Molecular Formula | C17H15F4NO2 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | COc1ccc(C(C)NC(=O)c2cccc(C(F)(F)F)c2)cc1F |
| InChI | InChI=1S/C17H15F4NO2/c1-10(11-6-7-15(24-2)14(18)9-11)22-16(23)12-4-3-5-13(8-12)17(19,20)21/h3-10H,1-2H3,(H,22,23) |
| InChIKey | DYMXGJNZKXSFSE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |