C18H20FNO3S — CID 86914769
N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-(methylsulfinylmethyl)benzamide (PubChem CID 86914769) has the molecular formula C18H20FNO3S and a molecular weight of 349.43 g/mol. Its IUPAC name is N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-(methylsulfinylmethyl)benzamide.
| Compound Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-(methylsulfinylmethyl)benzamide |
|---|---|
| PubChem CID | 86914769 |
| Molecular Formula | C18H20FNO3S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-3-(methylsulfinylmethyl)benzamide |
| SMILES | COc1ccc(C(C)NC(=O)c2cccc(CS(C)=O)c2)cc1F |
| InChI | InChI=1S/C18H20FNO3S/c1-12(14-7-8-17(23-2)16(19)10-14)20-18(21)15-6-4-5-13(9-15)11-24(3)22/h4-10,12H,11H2,1-3H3,(H,20,21) |
| InChIKey | JELOKWRQTSHOPG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |