C17H15F4NO3 — CID 18227017
N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-4-(trifluoromethoxy)benzamide (PubChem CID 18227017) has the molecular formula C17H15F4NO3 and a molecular weight of 357.30 g/mol. Its IUPAC name is N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 18227017 |
| Molecular Formula | C17H15F4NO3 |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-4-(trifluoromethoxy)benzamide |
| SMILES | COc1ccc(C(C)NC(=O)c2ccc(OC(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C17H15F4NO3/c1-10(12-5-8-15(24-2)14(18)9-12)22-16(23)11-3-6-13(7-4-11)25-17(19,20)21/h3-10H,1-2H3,(H,22,23) |
| InChIKey | SMMBDWTXWDJGFN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |