C18H18F3NO4 — CID 46423703
2,4-dimethoxy-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]benzamide (PubChem CID 46423703) has the molecular formula C18H18F3NO4 and a molecular weight of 369.34 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]benzamide.
| Compound Name | 2,4-dimethoxy-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 46423703 |
| Molecular Formula | C18H18F3NO4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2,4-dimethoxy-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NC(C)c2ccc(OC(F)(F)F)cc2)c(OC)c1 |
| InChI | InChI=1S/C18H18F3NO4/c1-11(12-4-6-13(7-5-12)26-18(19,20)21)22-17(23)15-9-8-14(24-2)10-16(15)25-3/h4-11H,1-3H3,(H,22,23) |
| InChIKey | XAHXWQLWYBTTOP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |