C16H15F4NO4S — CID 18097068
N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 18097068) has the molecular formula C16H15F4NO4S and a molecular weight of 393.36 g/mol. Its IUPAC name is N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 18097068 |
| Molecular Formula | C16H15F4NO4S |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | COc1ccc(C(C)NS(=O)(=O)c2ccc(OC(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C16H15F4NO4S/c1-10(11-3-8-15(24-2)14(17)9-11)21-26(22,23)13-6-4-12(5-7-13)25-16(18,19)20/h3-10,21H,1-2H3 |
| InChIKey | JFOPHIOROGMGHH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |