C16H19FN2O5S2 — CID 47084855
N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-4-(methanesulfonamido)benzenesulfonamide (PubChem CID 47084855) has the molecular formula C16H19FN2O5S2 and a molecular weight of 402.47 g/mol. Its IUPAC name is N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-4-(methanesulfonamido)benzenesulfonamide.
| Compound Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-4-(methanesulfonamido)benzenesulfonamide |
|---|---|
| PubChem CID | 47084855 |
| Molecular Formula | C16H19FN2O5S2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-4-(methanesulfonamido)benzenesulfonamide |
| SMILES | COc1ccc(C(C)NS(=O)(=O)c2ccc(NS(C)(=O)=O)cc2)cc1F |
| InChI | InChI=1S/C16H19FN2O5S2/c1-11(12-4-9-16(24-2)15(17)10-12)18-26(22,23)14-7-5-13(6-8-14)19-25(3,20)21/h4-11,18-19H,1-3H3 |
| InChIKey | BFRSCNUCRFMMJA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |