C15H17FN2O5S2 — CID 46633618
4-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]benzene-1,4-disulfonamide (PubChem CID 46633618) has the molecular formula C15H17FN2O5S2 and a molecular weight of 388.44 g/mol. Its IUPAC name is 4-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]benzene-1,4-disulfonamide.
| Compound Name | 4-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 46633618 |
| Molecular Formula | C15H17FN2O5S2 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 4-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]benzene-1,4-disulfonamide |
| SMILES | COc1ccc(C(C)NS(=O)(=O)c2ccc(S(N)(=O)=O)cc2)cc1F |
| InChI | InChI=1S/C15H17FN2O5S2/c1-10(11-3-8-15(23-2)14(16)9-11)18-25(21,22)13-6-4-12(5-7-13)24(17,19)20/h3-10,18H,1-2H3,(H2,17,19,20) |
| InChIKey | XOXLMNBWXHACQS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |