C17H14F3NO4 — CID 26111659
N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-4-(trifluoromethoxy)benzamide (PubChem CID 26111659) has the molecular formula C17H14F3NO4 and a molecular weight of 353.30 g/mol. Its IUPAC name is N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 26111659 |
| Molecular Formula | C17H14F3NO4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-4-(trifluoromethoxy)benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(OC(F)(F)F)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14F3NO4/c1-10(12-4-7-14-15(8-12)24-9-23-14)21-16(22)11-2-5-13(6-3-11)25-17(18,19)20/h2-8,10H,9H2,1H3,(H,21,22)/t10-/m0/s1 |
| InChIKey | JVJBPIQHABRIJP-JTQLQIEISA-N |
| XLogP | 3.80 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |