C20H21NO4 — CID 133230488
N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-4-prop-2-enoxybenzamide (PubChem CID 133230488) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-4-prop-2-enoxybenzamide.
| Compound Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 133230488 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)NC(C)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C20H21NO4/c1-3-10-23-17-7-4-15(5-8-17)20(22)21-14(2)16-6-9-18-19(13-16)25-12-11-24-18/h3-9,13-14H,1,10-12H2,2H3,(H,21,22) |
| InChIKey | OOUDUPQKSOHBDT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|