C20H23NO2 — CID 132650382
N-[1-(3,4-dimethylphenyl)ethyl]-4-prop-2-enoxybenzamide (PubChem CID 132650382) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)ethyl]-4-prop-2-enoxybenzamide.
| Compound Name | N-[1-(3,4-dimethylphenyl)ethyl]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 132650382 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)ethyl]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)NC(C)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C20H23NO2/c1-5-12-23-19-10-8-17(9-11-19)20(22)21-16(4)18-7-6-14(2)15(3)13-18/h5-11,13,16H,1,12H2,2-4H3,(H,21,22) |
| InChIKey | LAPSMUIFDVVORI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|