C18H18F3NO3 — CID 28560234
N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 28560234) has the molecular formula C18H18F3NO3 and a molecular weight of 353.34 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 28560234 |
| Molecular Formula | C18H18F3NO3 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | COc1ccc([C@@H](C)NC(=O)c2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C18H18F3NO3/c1-11(12-7-8-15(24-2)16(10-12)25-3)22-17(23)13-5-4-6-14(9-13)18(19,20)21/h4-11H,1-3H3,(H,22,23)/t11-/m1/s1 |
| InChIKey | ILUSHJPDUWNKAK-LLVKDONJSA-N |
| XLogP | 4.21 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |