C14H16F3NO3 — CID 43405923
methyl 3-methyl-2-[[3-(trifluoromethyl)benzoyl]amino]butanoate (PubChem CID 43405923) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is methyl 3-methyl-2-[[3-(trifluoromethyl)benzoyl]amino]butanoate.
| Compound Name | methyl 3-methyl-2-[[3-(trifluoromethyl)benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 43405923 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | methyl 3-methyl-2-[[3-(trifluoromethyl)benzoyl]amino]butanoate |
| SMILES | COC(=O)C(NC(=O)c1cccc(C(F)(F)F)c1)C(C)C |
| InChI | InChI=1S/C14H16F3NO3/c1-8(2)11(13(20)21-3)18-12(19)9-5-4-6-10(7-9)14(15,16)17/h4-8,11H,1-3H3,(H,18,19) |
| InChIKey | SEKKQEAYWVPGAN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |