C20H28F3NO3 — CID 91738163
heptyl 3-methyl-2-[[3-(trifluoromethyl)benzoyl]amino]butanoate (PubChem CID 91738163) has the molecular formula C20H28F3NO3 and a molecular weight of 387.44 g/mol. Its IUPAC name is heptyl 3-methyl-2-[[3-(trifluoromethyl)benzoyl]amino]butanoate.
| Compound Name | heptyl 3-methyl-2-[[3-(trifluoromethyl)benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 91738163 |
| Molecular Formula | C20H28F3NO3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | heptyl 3-methyl-2-[[3-(trifluoromethyl)benzoyl]amino]butanoate |
| SMILES | CCCCCCCOC(=O)C(NC(=O)c1cccc(C(F)(F)F)c1)C(C)C |
| InChI | InChI=1S/C20H28F3NO3/c1-4-5-6-7-8-12-27-19(26)17(14(2)3)24-18(25)15-10-9-11-16(13-15)20(21,22)23/h9-11,13-14,17H,4-8,12H2,1-3H3,(H,24,25) |
| InChIKey | NKJPNBPZFBJGCP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|