C20H27F4NO3 — CID 91739602
heptyl 2-[[3-fluoro-4-(trifluoromethyl)benzoyl]amino]-3-methylbutanoate (PubChem CID 91739602) has the molecular formula C20H27F4NO3 and a molecular weight of 405.43 g/mol. Its IUPAC name is heptyl 2-[[3-fluoro-4-(trifluoromethyl)benzoyl]amino]-3-methylbutanoate.
| Compound Name | heptyl 2-[[3-fluoro-4-(trifluoromethyl)benzoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 91739602 |
| Molecular Formula | C20H27F4NO3 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | heptyl 2-[[3-fluoro-4-(trifluoromethyl)benzoyl]amino]-3-methylbutanoate |
| SMILES | CCCCCCCOC(=O)C(NC(=O)c1ccc(C(F)(F)F)c(F)c1)C(C)C |
| InChI | InChI=1S/C20H27F4NO3/c1-4-5-6-7-8-11-28-19(27)17(13(2)3)25-18(26)14-9-10-15(16(21)12-14)20(22,23)24/h9-10,12-13,17H,4-8,11H2,1-3H3,(H,25,26) |
| InChIKey | QTGIMUPMJGCRRY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|