C20H29F2NO3 — CID 91734496
octyl 2-[(3,4-difluorobenzoyl)amino]-3-methylbutanoate (PubChem CID 91734496) has the molecular formula C20H29F2NO3 and a molecular weight of 369.45 g/mol. Its IUPAC name is octyl 2-[(3,4-difluorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | octyl 2-[(3,4-difluorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 91734496 |
| Molecular Formula | C20H29F2NO3 |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | octyl 2-[(3,4-difluorobenzoyl)amino]-3-methylbutanoate |
| SMILES | CCCCCCCCOC(=O)C(NC(=O)c1ccc(F)c(F)c1)C(C)C |
| InChI | InChI=1S/C20H29F2NO3/c1-4-5-6-7-8-9-12-26-20(25)18(14(2)3)23-19(24)15-10-11-16(21)17(22)13-15/h10-11,13-14,18H,4-9,12H2,1-3H3,(H,23,24) |
| InChIKey | BSAMHKZPUQVSLI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|