C14H16F3NO3 — CID 103926700
(2R)-3,3-dimethyl-2-[[3-(trifluoromethyl)benzoyl]amino]butanoic acid (PubChem CID 103926700) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is (2R)-3,3-dimethyl-2-[[3-(trifluoromethyl)benzoyl]amino]butanoic acid.
| Compound Name | (2R)-3,3-dimethyl-2-[[3-(trifluoromethyl)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 103926700 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (2R)-3,3-dimethyl-2-[[3-(trifluoromethyl)benzoyl]amino]butanoic acid |
| SMILES | CC(C)(C)[C@@H](NC(=O)c1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C14H16F3NO3/c1-13(2,3)10(12(20)21)18-11(19)8-5-4-6-9(7-8)14(15,16)17/h4-7,10H,1-3H3,(H,18,19)(H,20,21)/t10-/m0/s1 |
| InChIKey | LZQRTUTYKDSAIB-JTQLQIEISA-N |
| XLogP | 2.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |