C12H13BrF3NO — CID 83180357
N-(4-bromobutan-2-yl)-3-(trifluoromethyl)benzamide (PubChem CID 83180357) has the molecular formula C12H13BrF3NO and a molecular weight of 324.14 g/mol. Its IUPAC name is N-(4-bromobutan-2-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(4-bromobutan-2-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 83180357 |
| Molecular Formula | C12H13BrF3NO |
| Molecular Weight | 324.14 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | N-(4-bromobutan-2-yl)-3-(trifluoromethyl)benzamide |
| SMILES | CC(CCBr)NC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13BrF3NO/c1-8(5-6-13)17-11(18)9-3-2-4-10(7-9)12(14,15)16/h2-4,7-8H,5-6H2,1H3,(H,17,18) |
| InChIKey | JXUBOGFSKRZGMX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.14 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|