C14H17BrF3NO — CID 114317719
N-(4-bromo-2-ethylbutyl)-3-(trifluoromethyl)benzamide (PubChem CID 114317719) has the molecular formula C14H17BrF3NO and a molecular weight of 352.19 g/mol. Its IUPAC name is N-(4-bromo-2-ethylbutyl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(4-bromo-2-ethylbutyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 114317719 |
| Molecular Formula | C14H17BrF3NO |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | N-(4-bromo-2-ethylbutyl)-3-(trifluoromethyl)benzamide |
| SMILES | CCC(CCBr)CNC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17BrF3NO/c1-2-10(6-7-15)9-19-13(20)11-4-3-5-12(8-11)14(16,17)18/h3-5,8,10H,2,6-7,9H2,1H3,(H,19,20) |
| InChIKey | BEIFOKIACIMVTH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|