C15H19BrF3NO — CID 106288561
N-(2-bromo-3-ethylpentyl)-3-(trifluoromethyl)benzamide (PubChem CID 106288561) has the molecular formula C15H19BrF3NO and a molecular weight of 366.22 g/mol. Its IUPAC name is N-(2-bromo-3-ethylpentyl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(2-bromo-3-ethylpentyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 106288561 |
| Molecular Formula | C15H19BrF3NO |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-(2-bromo-3-ethylpentyl)-3-(trifluoromethyl)benzamide |
| SMILES | CCC(CC)C(Br)CNC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19BrF3NO/c1-3-10(4-2)13(16)9-20-14(21)11-6-5-7-12(8-11)15(17,18)19/h5-8,10,13H,3-4,9H2,1-2H3,(H,20,21) |
| InChIKey | RONUBWROGIIMJI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|