C10H9BrF3NO — CID 3500236
N-(2-bromoethyl)-3-(trifluoromethyl)benzamide (PubChem CID 3500236) has the molecular formula C10H9BrF3NO and a molecular weight of 296.09 g/mol. Its IUPAC name is N-(2-bromoethyl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(2-bromoethyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3500236 |
| Molecular Formula | C10H9BrF3NO |
| Molecular Weight | 296.09 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | N-(2-bromoethyl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCBr)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9BrF3NO/c11-4-5-15-9(16)7-2-1-3-8(6-7)10(12,13)14/h1-3,6H,4-5H2,(H,15,16) |
| InChIKey | CWHOYUCZUNXYPU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.09 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|