C15H20BrF2NO2 — CID 106288562
N-(2-bromo-3-ethylpentyl)-3-(difluoromethoxy)benzamide (PubChem CID 106288562) has the molecular formula C15H20BrF2NO2 and a molecular weight of 364.23 g/mol. Its IUPAC name is N-(2-bromo-3-ethylpentyl)-3-(difluoromethoxy)benzamide.
| Compound Name | N-(2-bromo-3-ethylpentyl)-3-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 106288562 |
| Molecular Formula | C15H20BrF2NO2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | N-(2-bromo-3-ethylpentyl)-3-(difluoromethoxy)benzamide |
| SMILES | CCC(CC)C(Br)CNC(=O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C15H20BrF2NO2/c1-3-10(4-2)13(16)9-19-14(20)11-6-5-7-12(8-11)21-15(17)18/h5-8,10,13,15H,3-4,9H2,1-2H3,(H,19,20) |
| InChIKey | QPPOBJLVCDWEHT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|