C12H15F2NO4 — CID 60653229
3-(difluoromethoxy)-N-(2,2-dimethoxyethyl)benzamide (PubChem CID 60653229) has the molecular formula C12H15F2NO4 and a molecular weight of 275.25 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-(2,2-dimethoxyethyl)benzamide.
| Compound Name | 3-(difluoromethoxy)-N-(2,2-dimethoxyethyl)benzamide |
|---|---|
| PubChem CID | 60653229 |
| Molecular Formula | C12H15F2NO4 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 3-(difluoromethoxy)-N-(2,2-dimethoxyethyl)benzamide |
| SMILES | COC(CNC(=O)c1cccc(OC(F)F)c1)OC |
| InChI | InChI=1S/C12H15F2NO4/c1-17-10(18-2)7-15-11(16)8-4-3-5-9(6-8)19-12(13)14/h3-6,10,12H,7H2,1-2H3,(H,15,16) |
| InChIKey | COUBGPDSYDIBJG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|