C13H16ClF2NO3 — CID 106243639
N-(3-chloro-4-methoxybutyl)-3-(difluoromethoxy)benzamide (PubChem CID 106243639) has the molecular formula C13H16ClF2NO3 and a molecular weight of 307.72 g/mol. Its IUPAC name is N-(3-chloro-4-methoxybutyl)-3-(difluoromethoxy)benzamide.
| Compound Name | N-(3-chloro-4-methoxybutyl)-3-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 106243639 |
| Molecular Formula | C13H16ClF2NO3 |
| Molecular Weight | 307.72 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(3-chloro-4-methoxybutyl)-3-(difluoromethoxy)benzamide |
| SMILES | COCC(Cl)CCNC(=O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C13H16ClF2NO3/c1-19-8-10(14)5-6-17-12(18)9-3-2-4-11(7-9)20-13(15)16/h2-4,7,10,13H,5-6,8H2,1H3,(H,17,18) |
| InChIKey | WTBJGWZYCOQKRF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.72 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|