C12H14F2N2O4 — CID 67330500
2-amino-4-[[3-(difluoromethoxy)benzoyl]amino]butanoic acid (PubChem CID 67330500) has the molecular formula C12H14F2N2O4 and a molecular weight of 288.25 g/mol. Its IUPAC name is 2-amino-4-[[3-(difluoromethoxy)benzoyl]amino]butanoic acid.
| Compound Name | 2-amino-4-[[3-(difluoromethoxy)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 67330500 |
| Molecular Formula | C12H14F2N2O4 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-amino-4-[[3-(difluoromethoxy)benzoyl]amino]butanoic acid |
| SMILES | NC(CCNC(=O)c1cccc(OC(F)F)c1)C(=O)O |
| InChI | InChI=1S/C12H14F2N2O4/c13-12(14)20-8-3-1-2-7(6-8)10(17)16-5-4-9(15)11(18)19/h1-3,6,9,12H,4-5,15H2,(H,16,17)(H,18,19) |
| InChIKey | GKGDLAVEYJRMHH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |